C26H20BrNO3S — CID 130405594
4-[(7-bromo-2-methyl-3-phenylnaphthalene-1-carbonyl)amino]-3-methylsulfanylbenzoic acid (PubChem CID 130405594) has the molecular formula C26H20BrNO3S and a molecular weight of 506.42 g/mol. Its IUPAC name is 4-[(7-bromo-2-methyl-3-phenylnaphthalene-1-carbonyl)amino]-3-methylsulfanylbenzoic acid.
| Compound Name | 4-[(7-bromo-2-methyl-3-phenylnaphthalene-1-carbonyl)amino]-3-methylsulfanylbenzoic acid |
|---|---|
| PubChem CID | 130405594 |
| Molecular Formula | C26H20BrNO3S |
| Molecular Weight | 506.42 g/mol |
| Exact Mass | 505.03 |
| IUPAC Name | 4-[(7-bromo-2-methyl-3-phenylnaphthalene-1-carbonyl)amino]-3-methylsulfanylbenzoic acid |
| SMILES | CSc1cc(C(=O)O)ccc1NC(=O)c1c(C)c(-c2ccccc2)cc2ccc(Br)cc12 |
| InChI | InChI=1S/C26H20BrNO3S/c1-15-20(16-6-4-3-5-7-16)12-17-8-10-19(27)14-21(17)24(15)25(29)28-22-11-9-18(26(30)31)13-23(22)32-2/h3-14H,1-2H3,(H,28,29)(H,30,31) |
| InChIKey | IVTLXOCQZVYGOJ-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.42 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |