C36H22Br2F6N2O4 — CID 159151175
6-bromo-3-methyl-2-[4-(trifluoromethyl)phenyl]quinoline-4-carboxylic acid (PubChem CID 159151175) has the molecular formula C36H22Br2F6N2O4 and a molecular weight of 820.38 g/mol. Its IUPAC name is 6-bromo-3-methyl-2-[4-(trifluoromethyl)phenyl]quinoline-4-carboxylic acid.
| Compound Name | 6-bromo-3-methyl-2-[4-(trifluoromethyl)phenyl]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 159151175 |
| Molecular Formula | C36H22Br2F6N2O4 |
| Molecular Weight | 820.38 g/mol |
| Exact Mass | 817.99 |
| IUPAC Name | 6-bromo-3-methyl-2-[4-(trifluoromethyl)phenyl]quinoline-4-carboxylic acid |
| SMILES | Cc1c(-c2ccc(C(F)(F)F)cc2)nc2ccc(Br)cc2c1C(=O)O.Cc1c(-c2ccc(C(F)(F)F)cc2)nc2ccc(Br)cc2c1C(=O)O |
| InChI | InChI=1S/2C18H11BrF3NO2/c2*1-9-15(17(24)25)13-8-12(19)6-7-14(13)23-16(9)10-2-4-11(5-3-10)18(20,21)22/h2*2-8H,1H3,(H,24,25) |
| InChIKey | KJHRMWHMGIUAKW-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.38 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |