C24H14F4NO2- — CID 91934812
6-fluoro-3-methyl-2-[4-[4-(trifluoromethyl)phenyl]phenyl]quinoline-4-carboxylate (PubChem CID 91934812) has the molecular formula C24H14F4NO2- and a molecular weight of 424.37 g/mol. Its IUPAC name is 6-fluoro-3-methyl-2-[4-[4-(trifluoromethyl)phenyl]phenyl]quinoline-4-carboxylate.
| Compound Name | 6-fluoro-3-methyl-2-[4-[4-(trifluoromethyl)phenyl]phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 91934812 |
| Molecular Formula | C24H14F4NO2- |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 6-fluoro-3-methyl-2-[4-[4-(trifluoromethyl)phenyl]phenyl]quinoline-4-carboxylate |
| SMILES | Cc1c(-c2ccc(-c3ccc(C(F)(F)F)cc3)cc2)nc2ccc(F)cc2c1C(=O)[O-] |
| InChI | InChI=1S/C24H15F4NO2/c1-13-21(23(30)31)19-12-18(25)10-11-20(19)29-22(13)16-4-2-14(3-5-16)15-6-8-17(9-7-15)24(26,27)28/h2-12H,1H3,(H,30,31)/p-1 |
| InChIKey | DXLFIRZKDFPENX-UHFFFAOYSA-M |
| XLogP | 5.40 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |