C23H14F2NO2- — CID 86309017
6-fluoro-2-[4-(2-fluorophenyl)phenyl]-3-methylquinoline-4-carboxylate (PubChem CID 86309017) has the molecular formula C23H14F2NO2- and a molecular weight of 374.37 g/mol. Its IUPAC name is 6-fluoro-2-[4-(2-fluorophenyl)phenyl]-3-methylquinoline-4-carboxylate.
| Compound Name | 6-fluoro-2-[4-(2-fluorophenyl)phenyl]-3-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 86309017 |
| Molecular Formula | C23H14F2NO2- |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 6-fluoro-2-[4-(2-fluorophenyl)phenyl]-3-methylquinoline-4-carboxylate |
| SMILES | Cc1c(-c2ccc(-c3ccccc3F)cc2)nc2ccc(F)cc2c1C(=O)[O-] |
| InChI | InChI=1S/C23H15F2NO2/c1-13-21(23(27)28)18-12-16(24)10-11-20(18)26-22(13)15-8-6-14(7-9-15)17-4-2-3-5-19(17)25/h2-12H,1H3,(H,27,28)/p-1 |
| InChIKey | PHEZJEYUWHETKO-UHFFFAOYSA-M |
| XLogP | 4.52 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |