C25H19F2NO2 — CID 162343089
ethyl 6-fluoro-2-[4-(2-fluorophenyl)phenyl]-3-methylquinoline-4-carboxylate (PubChem CID 162343089) has the molecular formula C25H19F2NO2 and a molecular weight of 403.43 g/mol. Its IUPAC name is ethyl 6-fluoro-2-[4-(2-fluorophenyl)phenyl]-3-methylquinoline-4-carboxylate.
| Compound Name | ethyl 6-fluoro-2-[4-(2-fluorophenyl)phenyl]-3-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 162343089 |
| Molecular Formula | C25H19F2NO2 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | ethyl 6-fluoro-2-[4-(2-fluorophenyl)phenyl]-3-methylquinoline-4-carboxylate |
| SMILES | CCOC(=O)c1c(C)c(-c2ccc(-c3ccccc3F)cc2)nc2ccc(F)cc12 |
| InChI | InChI=1S/C25H19F2NO2/c1-3-30-25(29)23-15(2)24(28-22-13-12-18(26)14-20(22)23)17-10-8-16(9-11-17)19-6-4-5-7-21(19)27/h4-14H,3H2,1-2H3 |
| InChIKey | AZFGFZLVRBIUQD-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |