C21H15NO5 — CID 15417172
ethyl 2-methoxy-6,11-dioxobenzo[b]acridine-12-carboxylate (PubChem CID 15417172) has the molecular formula C21H15NO5 and a molecular weight of 361.35 g/mol. Its IUPAC name is ethyl 2-methoxy-6,11-dioxobenzo[b]acridine-12-carboxylate.
| Compound Name | ethyl 2-methoxy-6,11-dioxobenzo[b]acridine-12-carboxylate |
|---|---|
| PubChem CID | 15417172 |
| Molecular Formula | C21H15NO5 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | ethyl 2-methoxy-6,11-dioxobenzo[b]acridine-12-carboxylate |
| SMILES | CCOC(=O)c1c2c(nc3ccc(OC)cc13)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H15NO5/c1-3-27-21(25)16-14-10-11(26-2)8-9-15(14)22-18-17(16)19(23)12-6-4-5-7-13(12)20(18)24/h4-10H,3H2,1-2H3 |
| InChIKey | LOQOSUADXQVNMR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|