C21H13BrO4 — CID 11327304
ethyl 3-bromo-6,11-dioxotetracene-5-carboxylate (PubChem CID 11327304) has the molecular formula C21H13BrO4 and a molecular weight of 409.24 g/mol. Its IUPAC name is ethyl 3-bromo-6,11-dioxotetracene-5-carboxylate.
| Compound Name | ethyl 3-bromo-6,11-dioxotetracene-5-carboxylate |
|---|---|
| PubChem CID | 11327304 |
| Molecular Formula | C21H13BrO4 |
| Molecular Weight | 409.24 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | ethyl 3-bromo-6,11-dioxotetracene-5-carboxylate |
| SMILES | CCOC(=O)c1c2c(cc3ccc(Br)cc13)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H13BrO4/c1-2-26-21(25)18-15-10-12(22)8-7-11(15)9-16-17(18)20(24)14-6-4-3-5-13(14)19(16)23/h3-10H,2H2,1H3 |
| InChIKey | YVGZSSOBEYOKBQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.24 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|