C28H23BrO4 — CID 135018432
diethyl 1-(4-bromophenyl)-4-phenylnaphthalene-2,3-dicarboxylate (PubChem CID 135018432) has the molecular formula C28H23BrO4 and a molecular weight of 503.39 g/mol. Its IUPAC name is diethyl 1-(4-bromophenyl)-4-phenylnaphthalene-2,3-dicarboxylate.
| Compound Name | diethyl 1-(4-bromophenyl)-4-phenylnaphthalene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 135018432 |
| Molecular Formula | C28H23BrO4 |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 502.08 |
| IUPAC Name | diethyl 1-(4-bromophenyl)-4-phenylnaphthalene-2,3-dicarboxylate |
| SMILES | CCOC(=O)c1c(C(=O)OCC)c(-c2ccc(Br)cc2)c2ccccc2c1-c1ccccc1 |
| InChI | InChI=1S/C28H23BrO4/c1-3-32-27(30)25-23(18-10-6-5-7-11-18)21-12-8-9-13-22(21)24(26(25)28(31)33-4-2)19-14-16-20(29)17-15-19/h5-17H,3-4H2,1-2H3 |
| InChIKey | WZHOCIIPHZKOJU-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |