C32H32N2O8 — CID 11731481
diethyl 5-[3,5-bis(ethoxycarbonyl)-4-phenyl-1H-pyrrol-2-yl]-3-phenyl-1H-pyrrole-2,4-dicarboxylate (PubChem CID 11731481) has the molecular formula C32H32N2O8 and a molecular weight of 572.61 g/mol. Its IUPAC name is diethyl 5-[3,5-bis(ethoxycarbonyl)-4-phenyl-1H-pyrrol-2-yl]-3-phenyl-1H-pyrrole-2,4-dicarboxylate.
| Compound Name | diethyl 5-[3,5-bis(ethoxycarbonyl)-4-phenyl-1H-pyrrol-2-yl]-3-phenyl-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 11731481 |
| Molecular Formula | C32H32N2O8 |
| Molecular Weight | 572.61 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | diethyl 5-[3,5-bis(ethoxycarbonyl)-4-phenyl-1H-pyrrol-2-yl]-3-phenyl-1H-pyrrole-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1[nH]c(-c2[nH]c(C(=O)OCC)c(-c3ccccc3)c2C(=O)OCC)c(C(=O)OCC)c1-c1ccccc1 |
| InChI | InChI=1S/C32H32N2O8/c1-5-39-29(35)23-21(19-15-11-9-12-16-19)27(31(37)41-7-3)33-25(23)26-24(30(36)40-6-2)22(20-17-13-10-14-18-20)28(34-26)32(38)42-8-4/h9-18,33-34H,5-8H2,1-4H3 |
| InChIKey | YEJOBJMAGVONIP-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 136.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.61 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|