C26H21NO3 — CID 146163429
ethyl 4-benzoyl-3,5-diphenyl-1H-pyrrole-2-carboxylate (PubChem CID 146163429) has the molecular formula C26H21NO3 and a molecular weight of 395.46 g/mol. Its IUPAC name is ethyl 4-benzoyl-3,5-diphenyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-benzoyl-3,5-diphenyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 146163429 |
| Molecular Formula | C26H21NO3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | ethyl 4-benzoyl-3,5-diphenyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(-c2ccccc2)c(C(=O)c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C26H21NO3/c1-2-30-26(29)24-21(18-12-6-3-7-13-18)22(25(28)20-16-10-5-11-17-20)23(27-24)19-14-8-4-9-15-19/h3-17,27H,2H2,1H3 |
| InChIKey | MEWMPJVKSPTMGB-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |