C27H21FO3 — CID 132550879
ethyl 6-(4-fluorophenyl)-2-hydroxy-3,4-diphenylbenzoate (PubChem CID 132550879) has the molecular formula C27H21FO3 and a molecular weight of 412.46 g/mol. Its IUPAC name is ethyl 6-(4-fluorophenyl)-2-hydroxy-3,4-diphenylbenzoate.
| Compound Name | ethyl 6-(4-fluorophenyl)-2-hydroxy-3,4-diphenylbenzoate |
|---|---|
| PubChem CID | 132550879 |
| Molecular Formula | C27H21FO3 |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | ethyl 6-(4-fluorophenyl)-2-hydroxy-3,4-diphenylbenzoate |
| SMILES | CCOC(=O)c1c(-c2ccc(F)cc2)cc(-c2ccccc2)c(-c2ccccc2)c1O |
| InChI | InChI=1S/C27H21FO3/c1-2-31-27(30)25-23(19-13-15-21(28)16-14-19)17-22(18-9-5-3-6-10-18)24(26(25)29)20-11-7-4-8-12-20/h3-17,29H,2H2,1H3 |
| InChIKey | XXPQHPVKAQZRBT-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |