C17H17ClO3 — CID 101384022
ethyl 5-chloro-2-hydroxy-3,6-dimethyl-4-phenylbenzoate (PubChem CID 101384022) has the molecular formula C17H17ClO3 and a molecular weight of 304.77 g/mol. Its IUPAC name is ethyl 5-chloro-2-hydroxy-3,6-dimethyl-4-phenylbenzoate.
| Compound Name | ethyl 5-chloro-2-hydroxy-3,6-dimethyl-4-phenylbenzoate |
|---|---|
| PubChem CID | 101384022 |
| Molecular Formula | C17H17ClO3 |
| Molecular Weight | 304.77 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | ethyl 5-chloro-2-hydroxy-3,6-dimethyl-4-phenylbenzoate |
| SMILES | CCOC(=O)c1c(C)c(Cl)c(-c2ccccc2)c(C)c1O |
| InChI | InChI=1S/C17H17ClO3/c1-4-21-17(20)14-10(2)15(18)13(11(3)16(14)19)12-8-6-5-7-9-12/h5-9,19H,4H2,1-3H3 |
| InChIKey | ZMLMFPWLRPUWOX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.77 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |