C22H19ClO4 — CID 10500140
diethyl 2-chloro-4-phenylazulene-1,3-dicarboxylate (PubChem CID 10500140) has the molecular formula C22H19ClO4 and a molecular weight of 382.84 g/mol. Its IUPAC name is diethyl 2-chloro-4-phenylazulene-1,3-dicarboxylate.
| Compound Name | diethyl 2-chloro-4-phenylazulene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 10500140 |
| Molecular Formula | C22H19ClO4 |
| Molecular Weight | 382.84 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | diethyl 2-chloro-4-phenylazulene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1c2ccccc(-c3ccccc3)c-2c(C(=O)OCC)c1Cl |
| InChI | InChI=1S/C22H19ClO4/c1-3-26-21(24)18-16-13-9-8-12-15(14-10-6-5-7-11-14)17(16)19(20(18)23)22(25)27-4-2/h5-13H,3-4H2,1-2H3 |
| InChIKey | NKMYBZGKRHMICK-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.84 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |