C23H16N2O3 — CID 100964726
ethyl 3,5-dicyano-2-hydroxy-4,6-diphenylbenzoate (PubChem CID 100964726) has the molecular formula C23H16N2O3 and a molecular weight of 368.39 g/mol. Its IUPAC name is ethyl 3,5-dicyano-2-hydroxy-4,6-diphenylbenzoate.
| Compound Name | ethyl 3,5-dicyano-2-hydroxy-4,6-diphenylbenzoate |
|---|---|
| PubChem CID | 100964726 |
| Molecular Formula | C23H16N2O3 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | ethyl 3,5-dicyano-2-hydroxy-4,6-diphenylbenzoate |
| SMILES | CCOC(=O)c1c(O)c(C#N)c(-c2ccccc2)c(C#N)c1-c1ccccc1 |
| InChI | InChI=1S/C23H16N2O3/c1-2-28-23(27)21-20(16-11-7-4-8-12-16)17(13-24)19(18(14-25)22(21)26)15-9-5-3-6-10-15/h3-12,26H,2H2,1H3 |
| InChIKey | ITAWLDQHCBLSDS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |