C20H17N3O4 — CID 102230049
diethyl 4-amino-3,5-dicyano-6-phenylbenzene-1,2-dicarboxylate (PubChem CID 102230049) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is diethyl 4-amino-3,5-dicyano-6-phenylbenzene-1,2-dicarboxylate.
| Compound Name | diethyl 4-amino-3,5-dicyano-6-phenylbenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 102230049 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | diethyl 4-amino-3,5-dicyano-6-phenylbenzene-1,2-dicarboxylate |
| SMILES | CCOC(=O)c1c(C#N)c(N)c(C#N)c(-c2ccccc2)c1C(=O)OCC |
| InChI | InChI=1S/C20H17N3O4/c1-3-26-19(24)16-14(11-22)18(23)13(10-21)15(12-8-6-5-7-9-12)17(16)20(25)27-4-2/h5-9H,3-4,23H2,1-2H3 |
| InChIKey | QEFLFMAONWHFOV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 126.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|