C46H34N6O4 — CID 139180404
ethyl 3-amino-2,4-dicyano-5,6-diphenylbenzoate (PubChem CID 139180404) has the molecular formula C46H34N6O4 and a molecular weight of 734.82 g/mol. Its IUPAC name is ethyl 3-amino-2,4-dicyano-5,6-diphenylbenzoate.
| Compound Name | ethyl 3-amino-2,4-dicyano-5,6-diphenylbenzoate |
|---|---|
| PubChem CID | 139180404 |
| Molecular Formula | C46H34N6O4 |
| Molecular Weight | 734.82 g/mol |
| Exact Mass | 734.26 |
| IUPAC Name | ethyl 3-amino-2,4-dicyano-5,6-diphenylbenzoate |
| SMILES | CCOC(=O)c1c(C#N)c(N)c(C#N)c(-c2ccccc2)c1-c1ccccc1.CCOC(=O)c1c(C#N)c(N)c(C#N)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/2C23H17N3O2/c2*1-2-28-23(27)21-18(14-25)22(26)17(13-24)19(15-9-5-3-6-10-15)20(21)16-11-7-4-8-12-16/h2*3-12H,2,26H2,1H3 |
| InChIKey | CIUHWVGFCJTUPG-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 199.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.82 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|