C36H23Cl2NO4 — CID 122377320
ethyl 2,5-dibenzoyl-3,4-bis(4-chlorophenyl)-6-cyanobenzoate (PubChem CID 122377320) has the molecular formula C36H23Cl2NO4 and a molecular weight of 604.49 g/mol. Its IUPAC name is ethyl 2,5-dibenzoyl-3,4-bis(4-chlorophenyl)-6-cyanobenzoate.
| Compound Name | ethyl 2,5-dibenzoyl-3,4-bis(4-chlorophenyl)-6-cyanobenzoate |
|---|---|
| PubChem CID | 122377320 |
| Molecular Formula | C36H23Cl2NO4 |
| Molecular Weight | 604.49 g/mol |
| Exact Mass | 603.10 |
| IUPAC Name | ethyl 2,5-dibenzoyl-3,4-bis(4-chlorophenyl)-6-cyanobenzoate |
| SMILES | CCOC(=O)c1c(C#N)c(C(=O)c2ccccc2)c(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)c1C(=O)c1ccccc1 |
| InChI | InChI=1S/C36H23Cl2NO4/c1-2-43-36(42)32-28(21-39)31(34(40)24-9-5-3-6-10-24)29(22-13-17-26(37)18-14-22)30(23-15-19-27(38)20-16-23)33(32)35(41)25-11-7-4-8-12-25/h3-20H,2H2,1H3 |
| InChIKey | OYVLYROBKMOBLY-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.49 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |