C18H18ClNO2S2 — CID 7032892
ethyl 5-[(2R)-butan-2-yl]sulfanyl-3-(4-chlorophenyl)-4-cyanothiophene-2-carboxylate (PubChem CID 7032892) has the molecular formula C18H18ClNO2S2 and a molecular weight of 379.93 g/mol. Its IUPAC name is ethyl 5-[(2R)-butan-2-yl]sulfanyl-3-(4-chlorophenyl)-4-cyanothiophene-2-carboxylate.
| Compound Name | ethyl 5-[(2R)-butan-2-yl]sulfanyl-3-(4-chlorophenyl)-4-cyanothiophene-2-carboxylate |
|---|---|
| PubChem CID | 7032892 |
| Molecular Formula | C18H18ClNO2S2 |
| Molecular Weight | 379.93 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | ethyl 5-[(2R)-butan-2-yl]sulfanyl-3-(4-chlorophenyl)-4-cyanothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(S[C@H](C)CC)c(C#N)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18ClNO2S2/c1-4-11(3)23-18-14(10-20)15(12-6-8-13(19)9-7-12)16(24-18)17(21)22-5-2/h6-9,11H,4-5H2,1-3H3/t11-/m1/s1 |
| InChIKey | WQNGDNNFSTXNFA-LLVKDONJSA-N |
| XLogP | 6.01 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.93 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |