C21H16N2O2S2 — CID 58873139
ethyl 4-cyano-3-[4-(5-cyanothiophen-2-yl)phenyl]-5-ethylthiophene-2-carboxylate (PubChem CID 58873139) has the molecular formula C21H16N2O2S2 and a molecular weight of 392.51 g/mol. Its IUPAC name is ethyl 4-cyano-3-[4-(5-cyanothiophen-2-yl)phenyl]-5-ethylthiophene-2-carboxylate.
| Compound Name | ethyl 4-cyano-3-[4-(5-cyanothiophen-2-yl)phenyl]-5-ethylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 58873139 |
| Molecular Formula | C21H16N2O2S2 |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | ethyl 4-cyano-3-[4-(5-cyanothiophen-2-yl)phenyl]-5-ethylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(CC)c(C#N)c1-c1ccc(-c2ccc(C#N)s2)cc1 |
| InChI | InChI=1S/C21H16N2O2S2/c1-3-17-16(12-23)19(20(27-17)21(24)25-4-2)14-7-5-13(6-8-14)18-10-9-15(11-22)26-18/h5-10H,3-4H2,1-2H3 |
| InChIKey | MNQMYXMVAJBRJD-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |