C16H16N2O4S3 — CID 68524429
ethyl 4-cyano-3-[4-(methanesulfonamido)phenyl]-5-methylsulfanylthiophene-2-carboxylate (PubChem CID 68524429) has the molecular formula C16H16N2O4S3 and a molecular weight of 396.52 g/mol. Its IUPAC name is ethyl 4-cyano-3-[4-(methanesulfonamido)phenyl]-5-methylsulfanylthiophene-2-carboxylate.
| Compound Name | ethyl 4-cyano-3-[4-(methanesulfonamido)phenyl]-5-methylsulfanylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 68524429 |
| Molecular Formula | C16H16N2O4S3 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | ethyl 4-cyano-3-[4-(methanesulfonamido)phenyl]-5-methylsulfanylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(SC)c(C#N)c1-c1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H16N2O4S3/c1-4-22-15(19)14-13(12(9-17)16(23-2)24-14)10-5-7-11(8-6-10)18-25(3,20)21/h5-8,18H,4H2,1-3H3 |
| InChIKey | UVSPMPFNJRMCII-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |