C11H11ClN2O3S2 — CID 15474680
ethyl 3-[(2-chloroacetyl)amino]-4-cyano-5-methylsulfanylthiophene-2-carboxylate (PubChem CID 15474680) has the molecular formula C11H11ClN2O3S2 and a molecular weight of 318.81 g/mol. Its IUPAC name is ethyl 3-[(2-chloroacetyl)amino]-4-cyano-5-methylsulfanylthiophene-2-carboxylate.
| Compound Name | ethyl 3-[(2-chloroacetyl)amino]-4-cyano-5-methylsulfanylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 15474680 |
| Molecular Formula | C11H11ClN2O3S2 |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | ethyl 3-[(2-chloroacetyl)amino]-4-cyano-5-methylsulfanylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(SC)c(C#N)c1NC(=O)CCl |
| InChI | InChI=1S/C11H11ClN2O3S2/c1-3-17-10(16)9-8(14-7(15)4-12)6(5-13)11(18-2)19-9/h3-4H2,1-2H3,(H,14,15) |
| InChIKey | CTIDSBDQVMJERX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|