diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate

C12H16O4S3 — CID 101083884

IUPACdiethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate
SMILESCCOC(=O)c1c(SC)sc(SC)c1C(=O)OCC
InChIInChI=1S/C12H16O4S3/c1-5-15-9(13)7-8(10(14)16-6-2)12(18-4)19-11(7)17-3/h5-6H2,1-4H3
InChIKeyQLTQWMHTVMLENG-UHFFFAOYSA-N
MW320.46 g/mol
LogP3.55
Rot. Bonds6

About diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate

diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate (PubChem CID 101083884) has the molecular formula C12H16O4S3 and a molecular weight of 320.46 g/mol. Its IUPAC name is diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate.

Molecular Properties

Compound Namediethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate
PubChem CID101083884
Molecular FormulaC12H16O4S3
Molecular Weight320.46 g/mol
Exact Mass320.02
IUPAC Namediethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate
SMILESCCOC(=O)c1c(SC)sc(SC)c1C(=O)OCC
InChIInChI=1S/C12H16O4S3/c1-5-15-9(13)7-8(10(14)16-6-2)12(18-4)19-11(7)17-3/h5-6H2,1-4H3
InChIKeyQLTQWMHTVMLENG-UHFFFAOYSA-N
XLogP3.55
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500320.46
LogP ≤ 53.55
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Analyze diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate?
The IUPAC name of diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate (CID 101083884) is diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate.
What is the SMILES notation for diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate?
The canonical SMILES for diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate is CCOC(=O)c1c(SC)sc(SC)c1C(=O)OCC.
What is the InChIKey of diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate?
The InChIKey is QLTQWMHTVMLENG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O4S3/c1-5-15-9(13)7-8(10(14)16-6-2)12(18-4)19-11(7)17-3/h5-6H2,1-4H3.
What are the key properties of diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate?
diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate has a molecular weight of 320.46 g/mol, XLogP of 3.55, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate is sourced from PubChem (CID 101083884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).