About diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate
diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate (PubChem CID 101083884) has the molecular formula C12H16O4S3
and a molecular weight of 320.46 g/mol. Its IUPAC name is diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate.
Analyze diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate?
The IUPAC name of diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate (CID 101083884) is diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate.
What is the SMILES notation for diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate?
The canonical SMILES for diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate is CCOC(=O)c1c(SC)sc(SC)c1C(=O)OCC.
What is the InChIKey of diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate?
The InChIKey is QLTQWMHTVMLENG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O4S3/c1-5-15-9(13)7-8(10(14)16-6-2)12(18-4)19-11(7)17-3/h5-6H2,1-4H3.
What are the key properties of diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate?
diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate has a molecular weight of 320.46 g/mol, XLogP of 3.55, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2,5-bis(methylsulfanyl)thiophene-3,4-dicarboxylate is sourced from PubChem (CID 101083884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).