C10H9O4S2Y- — CID 134836871
ethyl 3-hydroxy-5-methylsulfanyl-2H-thieno[3,2-b]furan-2-ide-6-carboxylate;yttrium (PubChem CID 134836871) has the molecular formula C10H9O4S2Y- and a molecular weight of 346.22 g/mol. Its IUPAC name is ethyl 3-hydroxy-5-methylsulfanyl-2H-thieno[3,2-b]furan-2-ide-6-carboxylate;yttrium.
| Compound Name | ethyl 3-hydroxy-5-methylsulfanyl-2H-thieno[3,2-b]furan-2-ide-6-carboxylate;yttrium |
|---|---|
| PubChem CID | 134836871 |
| Molecular Formula | C10H9O4S2Y- |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.90 |
| IUPAC Name | ethyl 3-hydroxy-5-methylsulfanyl-2H-thieno[3,2-b]furan-2-ide-6-carboxylate;yttrium |
| SMILES | CCOC(=O)c1c(SC)sc2c(O)[c-]oc12.[Y] |
| InChI | InChI=1S/C10H9O4S2.Y/c1-3-13-9(12)6-7-8(5(11)4-14-7)16-10(6)15-2;/h11H,3H2,1-2H3;/q-1; |
| InChIKey | KXVSEISZQBTZQX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|