C10H11NO2S4 — CID 10590722
ethyl 4-methyl-3-methylsulfanyl-5-sulfanylidenedithiolo[4,3-b]pyrrole-6-carboxylate (PubChem CID 10590722) has the molecular formula C10H11NO2S4 and a molecular weight of 305.47 g/mol. Its IUPAC name is ethyl 4-methyl-3-methylsulfanyl-5-sulfanylidenedithiolo[4,3-b]pyrrole-6-carboxylate.
| Compound Name | ethyl 4-methyl-3-methylsulfanyl-5-sulfanylidenedithiolo[4,3-b]pyrrole-6-carboxylate |
|---|---|
| PubChem CID | 10590722 |
| Molecular Formula | C10H11NO2S4 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 304.97 |
| IUPAC Name | ethyl 4-methyl-3-methylsulfanyl-5-sulfanylidenedithiolo[4,3-b]pyrrole-6-carboxylate |
| SMILES | CCOC(=O)c1c2ssc(SC)c-2n(C)c1=S |
| InChI | InChI=1S/C10H11NO2S4/c1-4-13-9(12)5-7-6(11(2)8(5)14)10(15-3)17-16-7/h4H2,1-3H3 |
| InChIKey | LBDBTQWOZDWEQD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|