C11H13ClO4S — CID 155671928
diethyl 5-chloro-3-methylthiophene-2,4-dicarboxylate (PubChem CID 155671928) has the molecular formula C11H13ClO4S and a molecular weight of 276.74 g/mol. Its IUPAC name is diethyl 5-chloro-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-chloro-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 155671928 |
| Molecular Formula | C11H13ClO4S |
| Molecular Weight | 276.74 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | diethyl 5-chloro-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(Cl)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C11H13ClO4S/c1-4-15-10(13)7-6(3)8(17-9(7)12)11(14)16-5-2/h4-5H2,1-3H3 |
| InChIKey | UEZOAAGWNRKFQZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.74 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |