C11H15NO3S2 — CID 102589254
ethyl 4-carbamoyl-5-ethylsulfanyl-3-methylthiophene-2-carboxylate (PubChem CID 102589254) has the molecular formula C11H15NO3S2 and a molecular weight of 273.38 g/mol. Its IUPAC name is ethyl 4-carbamoyl-5-ethylsulfanyl-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 4-carbamoyl-5-ethylsulfanyl-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 102589254 |
| Molecular Formula | C11H15NO3S2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | ethyl 4-carbamoyl-5-ethylsulfanyl-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(SCC)c(C(N)=O)c1C |
| InChI | InChI=1S/C11H15NO3S2/c1-4-15-10(14)8-6(3)7(9(12)13)11(17-8)16-5-2/h4-5H2,1-3H3,(H2,12,13) |
| InChIKey | AUEWFCSIJOPVST-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |