C11H17N3O2S2 — CID 103417444
3-amino-5-ethylsulfanyl-2-N-propylthiophene-2,4-dicarboxamide (PubChem CID 103417444) has the molecular formula C11H17N3O2S2 and a molecular weight of 287.41 g/mol. Its IUPAC name is 3-amino-5-ethylsulfanyl-2-N-propylthiophene-2,4-dicarboxamide.
| Compound Name | 3-amino-5-ethylsulfanyl-2-N-propylthiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 103417444 |
| Molecular Formula | C11H17N3O2S2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 3-amino-5-ethylsulfanyl-2-N-propylthiophene-2,4-dicarboxamide |
| SMILES | CCCNC(=O)c1sc(SCC)c(C(N)=O)c1N |
| InChI | InChI=1S/C11H17N3O2S2/c1-3-5-14-10(16)8-7(12)6(9(13)15)11(18-8)17-4-2/h3-5,12H2,1-2H3,(H2,13,15)(H,14,16) |
| InChIKey | ZZLTXMICHPCOCB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |