C13H22N2O2S2 — CID 103417474
3-amino-5-ethylsulfanyl-4-propan-2-yloxy-N-propylthiophene-2-carboxamide (PubChem CID 103417474) has the molecular formula C13H22N2O2S2 and a molecular weight of 302.47 g/mol. Its IUPAC name is 3-amino-5-ethylsulfanyl-4-propan-2-yloxy-N-propylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-ethylsulfanyl-4-propan-2-yloxy-N-propylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103417474 |
| Molecular Formula | C13H22N2O2S2 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 3-amino-5-ethylsulfanyl-4-propan-2-yloxy-N-propylthiophene-2-carboxamide |
| SMILES | CCCNC(=O)c1sc(SCC)c(OC(C)C)c1N |
| InChI | InChI=1S/C13H22N2O2S2/c1-5-7-15-12(16)11-9(14)10(17-8(3)4)13(19-11)18-6-2/h8H,5-7,14H2,1-4H3,(H,15,16) |
| InChIKey | KFDYLHDDKBUCKS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |