C14H23N3O2S — CID 103423712
3-amino-5-(cyclopropylamino)-4-propan-2-yloxy-N-propylthiophene-2-carboxamide (PubChem CID 103423712) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is 3-amino-5-(cyclopropylamino)-4-propan-2-yloxy-N-propylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-(cyclopropylamino)-4-propan-2-yloxy-N-propylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103423712 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 3-amino-5-(cyclopropylamino)-4-propan-2-yloxy-N-propylthiophene-2-carboxamide |
| SMILES | CCCNC(=O)c1sc(NC2CC2)c(OC(C)C)c1N |
| InChI | InChI=1S/C14H23N3O2S/c1-4-7-16-13(18)12-10(15)11(19-8(2)3)14(20-12)17-9-5-6-9/h8-9,17H,4-7,15H2,1-3H3,(H,16,18) |
| InChIKey | HKVWUTPEBXAJSU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |