C14H25N3O2S — CID 103425282
3-amino-5-(butylamino)-N-ethyl-4-propan-2-yloxythiophene-2-carboxamide (PubChem CID 103425282) has the molecular formula C14H25N3O2S and a molecular weight of 299.44 g/mol. Its IUPAC name is 3-amino-5-(butylamino)-N-ethyl-4-propan-2-yloxythiophene-2-carboxamide.
| Compound Name | 3-amino-5-(butylamino)-N-ethyl-4-propan-2-yloxythiophene-2-carboxamide |
|---|---|
| PubChem CID | 103425282 |
| Molecular Formula | C14H25N3O2S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 3-amino-5-(butylamino)-N-ethyl-4-propan-2-yloxythiophene-2-carboxamide |
| SMILES | CCCCNc1sc(C(=O)NCC)c(N)c1OC(C)C |
| InChI | InChI=1S/C14H25N3O2S/c1-5-7-8-17-14-11(19-9(3)4)10(15)12(20-14)13(18)16-6-2/h9,17H,5-8,15H2,1-4H3,(H,16,18) |
| InChIKey | IRLWWZCOHUIVQM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|