C12H18N4O2S — CID 103423057
3-amino-2-N-cyclopropyl-5-(propylamino)thiophene-2,4-dicarboxamide (PubChem CID 103423057) has the molecular formula C12H18N4O2S and a molecular weight of 282.37 g/mol. Its IUPAC name is 3-amino-2-N-cyclopropyl-5-(propylamino)thiophene-2,4-dicarboxamide.
| Compound Name | 3-amino-2-N-cyclopropyl-5-(propylamino)thiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 103423057 |
| Molecular Formula | C12H18N4O2S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 3-amino-2-N-cyclopropyl-5-(propylamino)thiophene-2,4-dicarboxamide |
| SMILES | CCCNc1sc(C(=O)NC2CC2)c(N)c1C(N)=O |
| InChI | InChI=1S/C12H18N4O2S/c1-2-5-15-12-7(10(14)17)8(13)9(19-12)11(18)16-6-3-4-6/h6,15H,2-5,13H2,1H3,(H2,14,17)(H,16,18) |
| InChIKey | QNWBERNDBJTAPF-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |