C11H15N3O3S — CID 103424181
methyl 4-amino-5-(cyclopropylcarbamoyl)-2-(methylamino)thiophene-3-carboxylate (PubChem CID 103424181) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is methyl 4-amino-5-(cyclopropylcarbamoyl)-2-(methylamino)thiophene-3-carboxylate.
| Compound Name | methyl 4-amino-5-(cyclopropylcarbamoyl)-2-(methylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 103424181 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | methyl 4-amino-5-(cyclopropylcarbamoyl)-2-(methylamino)thiophene-3-carboxylate |
| SMILES | CNc1sc(C(=O)NC2CC2)c(N)c1C(=O)OC |
| InChI | InChI=1S/C11H15N3O3S/c1-13-10-6(11(16)17-2)7(12)8(18-10)9(15)14-5-3-4-5/h5,13H,3-4,12H2,1-2H3,(H,14,15) |
| InChIKey | OZNMNTWGRUPZJJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |