C14H21N3O3S — CID 103423779
methyl 4-amino-5-(cyclopropylcarbamoyl)-2-(2-methylpropylamino)thiophene-3-carboxylate (PubChem CID 103423779) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is methyl 4-amino-5-(cyclopropylcarbamoyl)-2-(2-methylpropylamino)thiophene-3-carboxylate.
| Compound Name | methyl 4-amino-5-(cyclopropylcarbamoyl)-2-(2-methylpropylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 103423779 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | methyl 4-amino-5-(cyclopropylcarbamoyl)-2-(2-methylpropylamino)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NCC(C)C)sc(C(=O)NC2CC2)c1N |
| InChI | InChI=1S/C14H21N3O3S/c1-7(2)6-16-13-9(14(19)20-3)10(15)11(21-13)12(18)17-8-4-5-8/h7-8,16H,4-6,15H2,1-3H3,(H,17,18) |
| InChIKey | KTOCIDIWGAPHQA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |