C12H19N3O3S — CID 103423814
methyl 4-amino-5-(methylcarbamoyl)-2-(2-methylpropylamino)thiophene-3-carboxylate (PubChem CID 103423814) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is methyl 4-amino-5-(methylcarbamoyl)-2-(2-methylpropylamino)thiophene-3-carboxylate.
| Compound Name | methyl 4-amino-5-(methylcarbamoyl)-2-(2-methylpropylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 103423814 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | methyl 4-amino-5-(methylcarbamoyl)-2-(2-methylpropylamino)thiophene-3-carboxylate |
| SMILES | CNC(=O)c1sc(NCC(C)C)c(C(=O)OC)c1N |
| InChI | InChI=1S/C12H19N3O3S/c1-6(2)5-15-11-7(12(17)18-4)8(13)9(19-11)10(16)14-3/h6,15H,5,13H2,1-4H3,(H,14,16) |
| InChIKey | RVODSAGLRLWRLU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |