C12H19N3O4S — CID 103425033
methyl 3-amino-5-(1-methoxypropan-2-ylamino)-4-(methylcarbamoyl)thiophene-2-carboxylate (PubChem CID 103425033) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is methyl 3-amino-5-(1-methoxypropan-2-ylamino)-4-(methylcarbamoyl)thiophene-2-carboxylate.
| Compound Name | methyl 3-amino-5-(1-methoxypropan-2-ylamino)-4-(methylcarbamoyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 103425033 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | methyl 3-amino-5-(1-methoxypropan-2-ylamino)-4-(methylcarbamoyl)thiophene-2-carboxylate |
| SMILES | CNC(=O)c1c(NC(C)COC)sc(C(=O)OC)c1N |
| InChI | InChI=1S/C12H19N3O4S/c1-6(5-18-3)15-11-7(10(16)14-2)8(13)9(20-11)12(17)19-4/h6,15H,5,13H2,1-4H3,(H,14,16) |
| InChIKey | KVWJLIBXELUGNI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |