C14H22N4O2S — CID 103423511
3-amino-5-(butan-2-ylamino)-4-N-methyl-2-N-prop-2-enylthiophene-2,4-dicarboxamide (PubChem CID 103423511) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is 3-amino-5-(butan-2-ylamino)-4-N-methyl-2-N-prop-2-enylthiophene-2,4-dicarboxamide.
| Compound Name | 3-amino-5-(butan-2-ylamino)-4-N-methyl-2-N-prop-2-enylthiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 103423511 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 3-amino-5-(butan-2-ylamino)-4-N-methyl-2-N-prop-2-enylthiophene-2,4-dicarboxamide |
| SMILES | C=CCNC(=O)c1sc(NC(C)CC)c(C(=O)NC)c1N |
| InChI | InChI=1S/C14H22N4O2S/c1-5-7-17-13(20)11-10(15)9(12(19)16-4)14(21-11)18-8(3)6-2/h5,8,18H,1,6-7,15H2,2-4H3,(H,16,19)(H,17,20) |
| InChIKey | FQCWQHKIMQITDZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|