C13H20N4O2S — CID 103423232
3-amino-4-N-methyl-5-(propan-2-ylamino)-2-N-prop-2-enylthiophene-2,4-dicarboxamide (PubChem CID 103423232) has the molecular formula C13H20N4O2S and a molecular weight of 296.40 g/mol. Its IUPAC name is 3-amino-4-N-methyl-5-(propan-2-ylamino)-2-N-prop-2-enylthiophene-2,4-dicarboxamide.
| Compound Name | 3-amino-4-N-methyl-5-(propan-2-ylamino)-2-N-prop-2-enylthiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 103423232 |
| Molecular Formula | C13H20N4O2S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 3-amino-4-N-methyl-5-(propan-2-ylamino)-2-N-prop-2-enylthiophene-2,4-dicarboxamide |
| SMILES | C=CCNC(=O)c1sc(NC(C)C)c(C(=O)NC)c1N |
| InChI | InChI=1S/C13H20N4O2S/c1-5-6-16-12(19)10-9(14)8(11(18)15-4)13(20-10)17-7(2)3/h5,7,17H,1,6,14H2,2-4H3,(H,15,18)(H,16,19) |
| InChIKey | YQILMWAPRWRICS-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|