C14H20N4O2S — CID 103427603
3-amino-5-(1-cyclopropylethylamino)-2-N-prop-2-enylthiophene-2,4-dicarboxamide (PubChem CID 103427603) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 3-amino-5-(1-cyclopropylethylamino)-2-N-prop-2-enylthiophene-2,4-dicarboxamide.
| Compound Name | 3-amino-5-(1-cyclopropylethylamino)-2-N-prop-2-enylthiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 103427603 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 3-amino-5-(1-cyclopropylethylamino)-2-N-prop-2-enylthiophene-2,4-dicarboxamide |
| SMILES | C=CCNC(=O)c1sc(NC(C)C2CC2)c(C(N)=O)c1N |
| InChI | InChI=1S/C14H20N4O2S/c1-3-6-17-13(20)11-10(15)9(12(16)19)14(21-11)18-7(2)8-4-5-8/h3,7-8,18H,1,4-6,15H2,2H3,(H2,16,19)(H,17,20) |
| InChIKey | DCPDQKOJNZMAFN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|