C14H19N3O3S — CID 103424651
methyl 4-amino-2-(cyclopropylmethylamino)-5-(prop-2-enylcarbamoyl)thiophene-3-carboxylate (PubChem CID 103424651) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is methyl 4-amino-2-(cyclopropylmethylamino)-5-(prop-2-enylcarbamoyl)thiophene-3-carboxylate.
| Compound Name | methyl 4-amino-2-(cyclopropylmethylamino)-5-(prop-2-enylcarbamoyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 103424651 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | methyl 4-amino-2-(cyclopropylmethylamino)-5-(prop-2-enylcarbamoyl)thiophene-3-carboxylate |
| SMILES | C=CCNC(=O)c1sc(NCC2CC2)c(C(=O)OC)c1N |
| InChI | InChI=1S/C14H19N3O3S/c1-3-6-16-12(18)11-10(15)9(14(19)20-2)13(21-11)17-7-8-4-5-8/h3,8,17H,1,4-7,15H2,2H3,(H,16,18) |
| InChIKey | BWICRFVNBFWPOD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|