C12H16N2O3S — CID 103510086
methyl 4-amino-5-propanoyl-2-(prop-2-enylamino)thiophene-3-carboxylate (PubChem CID 103510086) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is methyl 4-amino-5-propanoyl-2-(prop-2-enylamino)thiophene-3-carboxylate.
| Compound Name | methyl 4-amino-5-propanoyl-2-(prop-2-enylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 103510086 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | methyl 4-amino-5-propanoyl-2-(prop-2-enylamino)thiophene-3-carboxylate |
| SMILES | C=CCNc1sc(C(=O)CC)c(N)c1C(=O)OC |
| InChI | InChI=1S/C12H16N2O3S/c1-4-6-14-11-8(12(16)17-3)9(13)10(18-11)7(15)5-2/h4,14H,1,5-6,13H2,2-3H3 |
| InChIKey | FSYHIPSIXXNXDD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|