C13H22N2O4S — CID 103425026
methyl 3-amino-5-(1-methoxypropan-2-ylamino)-4-propan-2-yloxythiophene-2-carboxylate (PubChem CID 103425026) has the molecular formula C13H22N2O4S and a molecular weight of 302.40 g/mol. Its IUPAC name is methyl 3-amino-5-(1-methoxypropan-2-ylamino)-4-propan-2-yloxythiophene-2-carboxylate.
| Compound Name | methyl 3-amino-5-(1-methoxypropan-2-ylamino)-4-propan-2-yloxythiophene-2-carboxylate |
|---|---|
| PubChem CID | 103425026 |
| Molecular Formula | C13H22N2O4S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | methyl 3-amino-5-(1-methoxypropan-2-ylamino)-4-propan-2-yloxythiophene-2-carboxylate |
| SMILES | COCC(C)Nc1sc(C(=O)OC)c(N)c1OC(C)C |
| InChI | InChI=1S/C13H22N2O4S/c1-7(2)19-10-9(14)11(13(16)18-5)20-12(10)15-8(3)6-17-4/h7-8,15H,6,14H2,1-5H3 |
| InChIKey | QCSSJAAINKXERM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |