C8H11N3O3S — CID 103424219
methyl 3-amino-4-carbamoyl-5-(methylamino)thiophene-2-carboxylate (PubChem CID 103424219) has the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. Its IUPAC name is methyl 3-amino-4-carbamoyl-5-(methylamino)thiophene-2-carboxylate.
| Compound Name | methyl 3-amino-4-carbamoyl-5-(methylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 103424219 |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | methyl 3-amino-4-carbamoyl-5-(methylamino)thiophene-2-carboxylate |
| SMILES | CNc1sc(C(=O)OC)c(N)c1C(N)=O |
| InChI | InChI=1S/C8H11N3O3S/c1-11-7-3(6(10)12)4(9)5(15-7)8(13)14-2/h11H,9H2,1-2H3,(H2,10,12) |
| InChIKey | CRGAAUGQXZEEDZ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |