C13H21N3O3S — CID 103420099
methyl 3-amino-4-carbamoyl-5-(hexylamino)thiophene-2-carboxylate (PubChem CID 103420099) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is methyl 3-amino-4-carbamoyl-5-(hexylamino)thiophene-2-carboxylate.
| Compound Name | methyl 3-amino-4-carbamoyl-5-(hexylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 103420099 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | methyl 3-amino-4-carbamoyl-5-(hexylamino)thiophene-2-carboxylate |
| SMILES | CCCCCCNc1sc(C(=O)OC)c(N)c1C(N)=O |
| InChI | InChI=1S/C13H21N3O3S/c1-3-4-5-6-7-16-12-8(11(15)17)9(14)10(20-12)13(18)19-2/h16H,3-7,14H2,1-2H3,(H2,15,17) |
| InChIKey | OBOQQYNEKCLNHR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|