C8H10N2O2S2 — CID 103526621
5-acetyl-4-amino-2-methylsulfanylthiophene-3-carboxamide (PubChem CID 103526621) has the molecular formula C8H10N2O2S2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 5-acetyl-4-amino-2-methylsulfanylthiophene-3-carboxamide.
| Compound Name | 5-acetyl-4-amino-2-methylsulfanylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 103526621 |
| Molecular Formula | C8H10N2O2S2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | 5-acetyl-4-amino-2-methylsulfanylthiophene-3-carboxamide |
| SMILES | CSc1sc(C(C)=O)c(N)c1C(N)=O |
| InChI | InChI=1S/C8H10N2O2S2/c1-3(11)6-5(9)4(7(10)12)8(13-2)14-6/h9H2,1-2H3,(H2,10,12) |
| InChIKey | YUHYYGIDKJRYRO-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |