C8H10N2O2S — CID 1271564
5-acetyl-2-amino-4-methylthiophene-3-carboxamide (PubChem CID 1271564) has the molecular formula C8H10N2O2S and a molecular weight of 198.25 g/mol. Its IUPAC name is 5-acetyl-2-amino-4-methylthiophene-3-carboxamide.
| Compound Name | 5-acetyl-2-amino-4-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 1271564 |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 5-acetyl-2-amino-4-methylthiophene-3-carboxamide |
| SMILES | CC(=O)c1sc(N)c(C(N)=O)c1C |
| InChI | InChI=1S/C8H10N2O2S/c1-3-5(7(9)12)8(10)13-6(3)4(2)11/h10H2,1-2H3,(H2,9,12) |
| InChIKey | KBRGADOLGGRECO-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|