C9H13N3O2S — CID 64975341
5-amino-2-N-ethyl-3-methylthiophene-2,4-dicarboxamide (PubChem CID 64975341) has the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. Its IUPAC name is 5-amino-2-N-ethyl-3-methylthiophene-2,4-dicarboxamide.
| Compound Name | 5-amino-2-N-ethyl-3-methylthiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 64975341 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 5-amino-2-N-ethyl-3-methylthiophene-2,4-dicarboxamide |
| SMILES | CCNC(=O)c1sc(N)c(C(N)=O)c1C |
| InChI | InChI=1S/C9H13N3O2S/c1-3-12-9(14)6-4(2)5(7(10)13)8(11)15-6/h3,11H2,1-2H3,(H2,10,13)(H,12,14) |
| InChIKey | MJTCFIBGSAVOFM-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|