C11H17N3O2S — CID 64975420
5-amino-2-N-ethyl-4-N,4-N,3-trimethylthiophene-2,4-dicarboxamide (PubChem CID 64975420) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 5-amino-2-N-ethyl-4-N,4-N,3-trimethylthiophene-2,4-dicarboxamide.
| Compound Name | 5-amino-2-N-ethyl-4-N,4-N,3-trimethylthiophene-2,4-dicarboxamide |
|---|---|
| PubChem CID | 64975420 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 5-amino-2-N-ethyl-4-N,4-N,3-trimethylthiophene-2,4-dicarboxamide |
| SMILES | CCNC(=O)c1sc(N)c(C(=O)N(C)C)c1C |
| InChI | InChI=1S/C11H17N3O2S/c1-5-13-10(15)8-6(2)7(9(12)17-8)11(16)14(3)4/h5,12H2,1-4H3,(H,13,15) |
| InChIKey | USPHOKCBEBVOQM-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|