C14H24N2OS — CID 43174820
2-amino-5-hexyl-N,N,4-trimethylthiophene-3-carboxamide (PubChem CID 43174820) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is 2-amino-5-hexyl-N,N,4-trimethylthiophene-3-carboxamide.
| Compound Name | 2-amino-5-hexyl-N,N,4-trimethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 43174820 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2-amino-5-hexyl-N,N,4-trimethylthiophene-3-carboxamide |
| SMILES | CCCCCCc1sc(N)c(C(=O)N(C)C)c1C |
| InChI | InChI=1S/C14H24N2OS/c1-5-6-7-8-9-11-10(2)12(13(15)18-11)14(17)16(3)4/h5-9,15H2,1-4H3 |
| InChIKey | BIFJKSSDHHZKIN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|