C18H28N2O4S — CID 5191754
ethyl 5-(dimethylcarbamoyl)-2-(heptanoylamino)-4-methylthiophene-3-carboxylate (PubChem CID 5191754) has the molecular formula C18H28N2O4S and a molecular weight of 368.50 g/mol. Its IUPAC name is ethyl 5-(dimethylcarbamoyl)-2-(heptanoylamino)-4-methylthiophene-3-carboxylate.
| Compound Name | ethyl 5-(dimethylcarbamoyl)-2-(heptanoylamino)-4-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 5191754 |
| Molecular Formula | C18H28N2O4S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | ethyl 5-(dimethylcarbamoyl)-2-(heptanoylamino)-4-methylthiophene-3-carboxylate |
| SMILES | CCCCCCC(=O)Nc1sc(C(=O)N(C)C)c(C)c1C(=O)OCC |
| InChI | InChI=1S/C18H28N2O4S/c1-6-8-9-10-11-13(21)19-16-14(18(23)24-7-2)12(3)15(25-16)17(22)20(4)5/h6-11H2,1-5H3,(H,19,21) |
| InChIKey | VFJIFUYWPDMXFT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|