C17H25NO6S — CID 28694173
4-O-ethyl 2-O-(2-methoxyethyl) 3-methyl-5-(pentanoylamino)thiophene-2,4-dicarboxylate (PubChem CID 28694173) has the molecular formula C17H25NO6S and a molecular weight of 371.46 g/mol. Its IUPAC name is 4-O-ethyl 2-O-(2-methoxyethyl) 3-methyl-5-(pentanoylamino)thiophene-2,4-dicarboxylate.
| Compound Name | 4-O-ethyl 2-O-(2-methoxyethyl) 3-methyl-5-(pentanoylamino)thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 28694173 |
| Molecular Formula | C17H25NO6S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 4-O-ethyl 2-O-(2-methoxyethyl) 3-methyl-5-(pentanoylamino)thiophene-2,4-dicarboxylate |
| SMILES | CCCCC(=O)Nc1sc(C(=O)OCCOC)c(C)c1C(=O)OCC |
| InChI | InChI=1S/C17H25NO6S/c1-5-7-8-12(19)18-15-13(16(20)23-6-2)11(3)14(25-15)17(21)24-10-9-22-4/h5-10H2,1-4H3,(H,18,19) |
| InChIKey | IHZPNQWPCYASMB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|